About CID 87768585
CID 87768585 (PubChem CID 87768585) has the molecular formula C18H29O2Si
and a molecular weight of 305.51 g/mol.
Molecular Properties
| Compound Name | CID 87768585 |
| PubChem CID | 87768585 |
| Molecular Formula | C18H29O2Si |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | — |
| SMILES | Cc1c(O[Si](C)C)cc(C=O)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C18H29O2Si/c1-12-14(20-21(8)9)10-13(11-19)16(18(5,6)7)15(12)17(2,3)4/h10-11H,1-9H3 |
| InChIKey | OSBZXLBWXXZHNU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87768585 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87768585?
The IUPAC name of CID 87768585 (CID 87768585) is not available.
What is the SMILES notation for CID 87768585?
The canonical SMILES for CID 87768585 is Cc1c(O[Si](C)C)cc(C=O)c(C(C)(C)C)c1C(C)(C)C.
What is the InChIKey of CID 87768585?
The InChIKey is OSBZXLBWXXZHNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29O2Si/c1-12-14(20-21(8)9)10-13(11-19)16(18(5,6)7)15(12)17(2,3)4/h10-11H,1-9H3.
What are the key properties of CID 87768585?
CID 87768585 has a molecular weight of 305.51 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87768585 is sourced from PubChem (CID 87768585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).