About 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid
4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid (PubChem CID 87768630) has the molecular formula C25H27ClN4O5
and a molecular weight of 498.97 g/mol. Its IUPAC name is 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid.
Molecular Properties
| Compound Name | 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid |
| PubChem CID | 87768630 |
| Molecular Formula | C25H27ClN4O5 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)Cc1cccc(Oc2ccccc2)c1)C(=O)O.Cc1cc(Cl)nc(C(N)=O)n1 |
| InChI | InChI=1S/C19H21NO4.C6H6ClN3O/c1-2-7-17(19(22)23)20-18(21)13-14-8-6-11-16(12-14)24-15-9-4-3-5-10-15;1-3-2-4(7)10-6(9-3)5(8)11/h3-6,8-12,17H,2,7,13H2,1H3,(H,20,21)(H,22,23);2H,1H3,(H2,8,11) |
| InChIKey | SKHRONIFCABOJJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid?
The IUPAC name of 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid (CID 87768630) is 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid.
What is the SMILES notation for 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid?
The canonical SMILES for 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid is CCCC(NC(=O)Cc1cccc(Oc2ccccc2)c1)C(=O)O.Cc1cc(Cl)nc(C(N)=O)n1.
What is the InChIKey of 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid?
The InChIKey is SKHRONIFCABOJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4.C6H6ClN3O/c1-2-7-17(19(22)23)20-18(21)13-14-8-6-11-16(12-14)24-15-9-4-3-5-10-15;1-3-2-4(7)10-6(9-3)5(8)11/h3-6,8-12,17H,2,7,13H2,1H3,(H,20,21)(H,22,23);2H,1H3,(H2,8,11).
What are the key properties of 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid?
4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid has a molecular weight of 498.97 g/mol, XLogP of 3.93, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-methylpyrimidine-2-carboxamide;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid is sourced from PubChem (CID 87768630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).