About 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid
4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid (PubChem CID 87768631) has the molecular formula C24H27ClN4O4
and a molecular weight of 470.96 g/mol. Its IUPAC name is 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid.
Molecular Properties
| Compound Name | 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid |
| PubChem CID | 87768631 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)Cc1cccc(Oc2ccccc2)c1)C(=O)O.Cc1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C19H21NO4.C5H6ClN3/c1-2-7-17(19(22)23)20-18(21)13-14-8-6-11-16(12-14)24-15-9-4-3-5-10-15;1-3-2-4(6)9-5(7)8-3/h3-6,8-12,17H,2,7,13H2,1H3,(H,20,21)(H,22,23);2H,1H3,(H2,7,8,9) |
| InChIKey | GCMVTXGVHDRRGB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid?
The IUPAC name of 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid (CID 87768631) is 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid.
What is the SMILES notation for 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid?
The canonical SMILES for 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid is CCCC(NC(=O)Cc1cccc(Oc2ccccc2)c1)C(=O)O.Cc1cc(Cl)nc(N)n1.
What is the InChIKey of 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid?
The InChIKey is GCMVTXGVHDRRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4.C5H6ClN3/c1-2-7-17(19(22)23)20-18(21)13-14-8-6-11-16(12-14)24-15-9-4-3-5-10-15;1-3-2-4(6)9-5(7)8-3/h3-6,8-12,17H,2,7,13H2,1H3,(H,20,21)(H,22,23);2H,1H3,(H2,7,8,9).
What are the key properties of 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid?
4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid has a molecular weight of 470.96 g/mol, XLogP of 4.41, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-methylpyrimidin-2-amine;2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanoic acid is sourced from PubChem (CID 87768631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).