About (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide
(2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide (PubChem CID 87768711) has the molecular formula C19H14F6N2O2
and a molecular weight of 416.32 g/mol. Its IUPAC name is (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide.
Molecular Properties
| Compound Name | (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide |
| PubChem CID | 87768711 |
| Molecular Formula | C19H14F6N2O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide |
| SMILES | CO[C@H](C(=O)NCc1ccc(C#N)cc1)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14F6N2O2/c1-29-16(17(28)27-10-12-4-2-11(9-26)3-5-12)14-7-6-13(18(20,21)22)8-15(14)19(23,24)25/h2-8,16H,10H2,1H3,(H,27,28)/t16-/m0/s1 |
| InChIKey | BLJOFOMLEBMAPN-INIZCTEOSA-N |
| XLogP | 4.60 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide?
The IUPAC name of (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide (CID 87768711) is (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide.
What is the SMILES notation for (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide?
The canonical SMILES for (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide is CO[C@H](C(=O)NCc1ccc(C#N)cc1)c1ccc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide?
The InChIKey is BLJOFOMLEBMAPN-INIZCTEOSA-N. The full InChI is InChI=1S/C19H14F6N2O2/c1-29-16(17(28)27-10-12-4-2-11(9-26)3-5-12)14-7-6-13(18(20,21)22)8-15(14)19(23,24)25/h2-8,16H,10H2,1H3,(H,27,28)/t16-/m0/s1.
What are the key properties of (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide?
(2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide has a molecular weight of 416.32 g/mol, XLogP of 4.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[2,4-bis(trifluoromethyl)phenyl]-N-[(4-cyanophenyl)methyl]-2-methoxyacetamide is sourced from PubChem (CID 87768711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).