C23H22F4N4O2 — CID 87768732
(E)-3-[3-[1-[(3R)-1-ethylpiperidin-3-yl]-4,5,6,7-tetrafluorobenzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 87768732) has the molecular formula C23H22F4N4O2 and a molecular weight of 462.45 g/mol. Its IUPAC name is (E)-3-[3-[1-[(3R)-1-ethylpiperidin-3-yl]-4,5,6,7-tetrafluorobenzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-[1-[(3R)-1-ethylpiperidin-3-yl]-4,5,6,7-tetrafluorobenzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 87768732 |
| Molecular Formula | C23H22F4N4O2 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (E)-3-[3-[1-[(3R)-1-ethylpiperidin-3-yl]-4,5,6,7-tetrafluorobenzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCN1CCC[C@@H](n2c(-c3cccc(/C=C/C(=O)NO)c3)nc3c(F)c(F)c(F)c(F)c32)C1 |
| InChI | InChI=1S/C23H22F4N4O2/c1-2-30-10-4-7-15(12-30)31-22-20(27)18(25)17(24)19(26)21(22)28-23(31)14-6-3-5-13(11-14)8-9-16(32)29-33/h3,5-6,8-9,11,15,33H,2,4,7,10,12H2,1H3,(H,29,32)/b9-8+/t15-/m1/s1 |
| InChIKey | BEWMTDXOBGUAJI-XVJNWHFHSA-N |
| XLogP | 4.44 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|