About [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate
[4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 87769331) has the molecular formula C32H32N2O9
and a molecular weight of 588.61 g/mol. Its IUPAC name is [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 87769331 |
| Molecular Formula | C32H32N2O9 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(ONc1ccc(OCCCCCCOC2CCCCO2)cc1)c1cc2c(c([N+](=O)[O-])c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C32H32N2O9/c35-30-24-9-3-4-10-25(24)31(36)29-26(30)19-21(20-27(29)34(38)39)32(37)43-33-22-12-14-23(15-13-22)40-16-6-1-2-7-17-41-28-11-5-8-18-42-28/h3-4,9-10,12-15,19-20,28,33H,1-2,5-8,11,16-18H2 |
| InChIKey | XBDWNCVQTVEPAR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate (CID 87769331) is [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate is O=C(ONc1ccc(OCCCCCCOC2CCCCO2)cc1)c1cc2c(c([N+](=O)[O-])c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate?
The InChIKey is XBDWNCVQTVEPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32N2O9/c35-30-24-9-3-4-10-25(24)31(36)29-26(30)19-21(20-27(29)34(38)39)32(37)43-33-22-12-14-23(15-13-22)40-16-6-1-2-7-17-41-28-11-5-8-18-42-28/h3-4,9-10,12-15,19-20,28,33H,1-2,5-8,11,16-18H2.
What are the key properties of [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate?
[4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate has a molecular weight of 588.61 g/mol, XLogP of 6.04, 13 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[6-(oxan-2-yloxy)hexoxy]anilino] 4-nitro-9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 87769331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).