C29H26O3Se — CID 87769351
4-[2-[[5-(4-methoxyphenyl)-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]ethynyl]-2-methylbenzoic acid (PubChem CID 87769351) has the molecular formula C29H26O3Se and a molecular weight of 501.48 g/mol. Its IUPAC name is 4-[2-[[5-(4-methoxyphenyl)-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]ethynyl]-2-methylbenzoic acid.
| Compound Name | 4-[2-[[5-(4-methoxyphenyl)-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]ethynyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 87769351 |
| Molecular Formula | C29H26O3Se |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 4-[2-[[5-(4-methoxyphenyl)-8,8-dimethyl-7H-naphthalen-2-yl]selanyl]ethynyl]-2-methylbenzoic acid |
| SMILES | COc1ccc(C2=CCC(C)(C)c3cc([Se]C#Cc4ccc(C(=O)O)c(C)c4)ccc32)cc1 |
| InChI | InChI=1S/C29H26O3Se/c1-19-17-20(5-11-24(19)28(30)31)14-16-33-23-10-12-26-25(13-15-29(2,3)27(26)18-23)21-6-8-22(32-4)9-7-21/h5-13,17-18H,15H2,1-4H3,(H,30,31) |
| InChIKey | WBUYXCVLQSMYME-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|