About 1-benzofuran-5-diazonium
1-benzofuran-5-diazonium (PubChem CID 87769506) has the molecular formula C8H5N2O+
and a molecular weight of 145.14 g/mol. Its IUPAC name is 1-benzofuran-5-diazonium.
Molecular Properties
| Compound Name | 1-benzofuran-5-diazonium |
| PubChem CID | 87769506 |
| Molecular Formula | C8H5N2O+ |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 1-benzofuran-5-diazonium |
| SMILES | N#[N+]c1ccc2occc2c1 |
| InChI | InChI=1S/C8H5N2O/c9-10-7-1-2-8-6(5-7)3-4-11-8/h1-5H/q+1 |
| InChIKey | HZGNRBKIOKEKDX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-5-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-5-diazonium?
The IUPAC name of 1-benzofuran-5-diazonium (CID 87769506) is 1-benzofuran-5-diazonium.
What is the SMILES notation for 1-benzofuran-5-diazonium?
The canonical SMILES for 1-benzofuran-5-diazonium is N#[N+]c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran-5-diazonium?
The InChIKey is HZGNRBKIOKEKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N2O/c9-10-7-1-2-8-6(5-7)3-4-11-8/h1-5H/q+1.
What are the key properties of 1-benzofuran-5-diazonium?
1-benzofuran-5-diazonium has a molecular weight of 145.14 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-5-diazonium is sourced from PubChem (CID 87769506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).