C17H11F11O3S2 — CID 87769687
2-fluoro-1-(5-thiophen-2-ylthiophen-2-yl)-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one (PubChem CID 87769687) has the molecular formula C17H11F11O3S2 and a molecular weight of 536.38 g/mol. Its IUPAC name is 2-fluoro-1-(5-thiophen-2-ylthiophen-2-yl)-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one.
| Compound Name | 2-fluoro-1-(5-thiophen-2-ylthiophen-2-yl)-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one |
|---|---|
| PubChem CID | 87769687 |
| Molecular Formula | C17H11F11O3S2 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | 2-fluoro-1-(5-thiophen-2-ylthiophen-2-yl)-2-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propan-1-one |
| SMILES | CC(F)(OC(F)(F)C(C)(F)OC(F)(F)C(F)(F)C(F)(F)F)C(=O)c1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C17H11F11O3S2/c1-12(18,11(29)10-6-5-9(33-10)8-4-3-7-32-8)30-16(25,26)13(2,19)31-17(27,28)14(20,21)15(22,23)24/h3-7H,1-2H3 |
| InChIKey | FUTGFPBCUOUCDQ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|