About 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate
1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate (PubChem CID 87769774) has the molecular formula C12H21ClO2
and a molecular weight of 232.75 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate.
Molecular Properties
| Compound Name | 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate |
| PubChem CID | 87769774 |
| Molecular Formula | C12H21ClO2 |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate |
| SMILES | CC(OC(=O)CCl)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C12H21ClO2/c1-9(15-11(14)8-13)10-5-4-6-12(2,3)7-10/h9-10H,4-8H2,1-3H3 |
| InChIKey | YPPHDCQZYJMYDN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate?
The IUPAC name of 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate (CID 87769774) is 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate.
What is the SMILES notation for 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate?
The canonical SMILES for 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate is CC(OC(=O)CCl)C1CCCC(C)(C)C1.
What is the InChIKey of 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate?
The InChIKey is YPPHDCQZYJMYDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClO2/c1-9(15-11(14)8-13)10-5-4-6-12(2,3)7-10/h9-10H,4-8H2,1-3H3.
What are the key properties of 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate?
1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate has a molecular weight of 232.75 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylcyclohexyl)ethyl 2-chloroacetate is sourced from PubChem (CID 87769774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).