C30H36Cl2N5O8PS — CID 87770199
[1-[[3-[(1-amino-3-methyl-1-sulfanylidenepentan-2-yl)carbamoyl]-6,8-dichloro-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-1-oxo-4-(4-phosphonooxyphenyl)butan-2-yl]carbamic acid (PubChem CID 87770199) has the molecular formula C30H36Cl2N5O8PS and a molecular weight of 728.59 g/mol. Its IUPAC name is [1-[[3-[(1-amino-3-methyl-1-sulfanylidenepentan-2-yl)carbamoyl]-6,8-dichloro-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-1-oxo-4-(4-phosphonooxyphenyl)butan-2-yl]carbamic acid.
| Compound Name | [1-[[3-[(1-amino-3-methyl-1-sulfanylidenepentan-2-yl)carbamoyl]-6,8-dichloro-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-1-oxo-4-(4-phosphonooxyphenyl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87770199 |
| Molecular Formula | C30H36Cl2N5O8PS |
| Molecular Weight | 728.59 g/mol |
| Exact Mass | 727.14 |
| IUPAC Name | [1-[[3-[(1-amino-3-methyl-1-sulfanylidenepentan-2-yl)carbamoyl]-6,8-dichloro-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-1-oxo-4-(4-phosphonooxyphenyl)butan-2-yl]carbamic acid |
| SMILES | CCC(C)C(NC(=O)C1(NC(=O)C(CCc2ccc(OP(=O)(O)O)cc2)NC(=O)O)CCc2[nH]c3c(Cl)cc(Cl)cc3c2C1)C(N)=S |
| InChI | InChI=1S/C30H36Cl2N5O8PS/c1-3-15(2)24(26(33)47)36-28(39)30(11-10-22-20(14-30)19-12-17(31)13-21(32)25(19)34-22)37-27(38)23(35-29(40)41)9-6-16-4-7-18(8-5-16)45-46(42,43)44/h4-5,7-8,12-13,15,23-24,34-35H,3,6,9-11,14H2,1-2H3,(H2,33,47)(H,36,39)(H,37,38)(H,40,41)(H2,42,43,44) |
| InChIKey | VSGWDSBSFWIHPN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 216.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|