About 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol
2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol (PubChem CID 87770279) has the molecular formula C14H32O2
and a molecular weight of 232.41 g/mol. Its IUPAC name is 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol.
Molecular Properties
| Compound Name | 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol |
| PubChem CID | 87770279 |
| Molecular Formula | C14H32O2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.24 |
| IUPAC Name | 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol |
| SMILES | CCC(C)(O)C(C)C.CCC(O)(CC)CC |
| InChI | InChI=1S/2C7H16O/c1-5-7(4,8)6(2)3;1-4-7(8,5-2)6-3/h6,8H,5H2,1-4H3;8H,4-6H2,1-3H3 |
| InChIKey | CISXNBZGLJHFAQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol?
The IUPAC name of 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol (CID 87770279) is 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol.
What is the SMILES notation for 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol?
The canonical SMILES for 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol is CCC(C)(O)C(C)C.CCC(O)(CC)CC.
What is the InChIKey of 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol?
The InChIKey is CISXNBZGLJHFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H16O/c1-5-7(4,8)6(2)3;1-4-7(8,5-2)6-3/h6,8H,5H2,1-4H3;8H,4-6H2,1-3H3.
What are the key properties of 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol?
2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol has a molecular weight of 232.41 g/mol, XLogP of 3.75, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylpentan-3-ol;3-ethylpentan-3-ol is sourced from PubChem (CID 87770279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).