About 2-(2-aminoethyl)butane-1,4-diol
2-(2-aminoethyl)butane-1,4-diol (PubChem CID 87770529) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-(2-aminoethyl)butane-1,4-diol.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)butane-1,4-diol |
| PubChem CID | 87770529 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 2-(2-aminoethyl)butane-1,4-diol |
| SMILES | NCCC(CO)CCO |
| InChI | InChI=1S/C6H15NO2/c7-3-1-6(5-9)2-4-8/h6,8-9H,1-5,7H2 |
| InChIKey | WOXNREIFRRHAEP-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-aminoethyl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)butane-1,4-diol?
The IUPAC name of 2-(2-aminoethyl)butane-1,4-diol (CID 87770529) is 2-(2-aminoethyl)butane-1,4-diol.
What is the SMILES notation for 2-(2-aminoethyl)butane-1,4-diol?
The canonical SMILES for 2-(2-aminoethyl)butane-1,4-diol is NCCC(CO)CCO.
What is the InChIKey of 2-(2-aminoethyl)butane-1,4-diol?
The InChIKey is WOXNREIFRRHAEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2/c7-3-1-6(5-9)2-4-8/h6,8-9H,1-5,7H2.
What are the key properties of 2-(2-aminoethyl)butane-1,4-diol?
2-(2-aminoethyl)butane-1,4-diol has a molecular weight of 133.19 g/mol, XLogP of -0.67, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)butane-1,4-diol is sourced from PubChem (CID 87770529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).