About tetrapropoxyazanium bromide
tetrapropoxyazanium bromide (PubChem CID 87770542) has the molecular formula C12H28BrNO4
and a molecular weight of 330.26 g/mol. Its IUPAC name is tetrapropoxyazanium bromide.
Molecular Properties
| Compound Name | tetrapropoxyazanium bromide |
| PubChem CID | 87770542 |
| Molecular Formula | C12H28BrNO4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | tetrapropoxyazanium bromide |
| SMILES | CCCO[N+](OCCC)(OCCC)OCCC.[Br-] |
| InChI | InChI=1S/C12H28NO4.BrH/c1-5-9-14-13(15-10-6-2,16-11-7-3)17-12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | MBFFOWQXCKRLTC-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrapropoxyazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropoxyazanium bromide?
The IUPAC name of tetrapropoxyazanium bromide (CID 87770542) is tetrapropoxyazanium bromide.
What is the SMILES notation for tetrapropoxyazanium bromide?
The canonical SMILES for tetrapropoxyazanium bromide is CCCO[N+](OCCC)(OCCC)OCCC.[Br-].
What is the InChIKey of tetrapropoxyazanium bromide?
The InChIKey is MBFFOWQXCKRLTC-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28NO4.BrH/c1-5-9-14-13(15-10-6-2,16-11-7-3)17-12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1.
What are the key properties of tetrapropoxyazanium bromide?
tetrapropoxyazanium bromide has a molecular weight of 330.26 g/mol, XLogP of 0.17, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropoxyazanium bromide is sourced from PubChem (CID 87770542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).