About [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid
[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid (PubChem CID 87770559) has the molecular formula C9H11N3O6
and a molecular weight of 257.20 g/mol. Its IUPAC name is [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid.
Molecular Properties
| Compound Name | [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid |
| PubChem CID | 87770559 |
| Molecular Formula | C9H11N3O6 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid |
| SMILES | O=C(O)NOCC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11N3O6/c13-6(5-18-11-9(16)17)10-3-4-12-7(14)1-2-8(12)15/h1-2,11H,3-5H2,(H,10,13)(H,16,17) |
| InChIKey | FNMUFEJSQVCGCY-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid?
The IUPAC name of [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid (CID 87770559) is [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid.
What is the SMILES notation for [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid?
The canonical SMILES for [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid is O=C(O)NOCC(=O)NCCN1C(=O)C=CC1=O.
What is the InChIKey of [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid?
The InChIKey is FNMUFEJSQVCGCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O6/c13-6(5-18-11-9(16)17)10-3-4-12-7(14)1-2-8(12)15/h1-2,11H,3-5H2,(H,10,13)(H,16,17).
What are the key properties of [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid?
[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid has a molecular weight of 257.20 g/mol, XLogP of -1.77, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethoxy]carbamic acid is sourced from PubChem (CID 87770559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).