About O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate
O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate (PubChem CID 87770893) has the molecular formula C13H18FNOS
and a molecular weight of 255.36 g/mol. Its IUPAC name is O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate.
Molecular Properties
| Compound Name | O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate |
| PubChem CID | 87770893 |
| Molecular Formula | C13H18FNOS |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate |
| SMILES | CCC[C@H](NCc1ccc(F)cc1)C(=S)OC |
| InChI | InChI=1S/C13H18FNOS/c1-3-4-12(13(17)16-2)15-9-10-5-7-11(14)8-6-10/h5-8,12,15H,3-4,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | KFPUFYPCNKDHBJ-LBPRGKRZSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate?
The IUPAC name of O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate (CID 87770893) is O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate.
What is the SMILES notation for O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate?
The canonical SMILES for O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate is CCC[C@H](NCc1ccc(F)cc1)C(=S)OC.
What is the InChIKey of O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate?
The InChIKey is KFPUFYPCNKDHBJ-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H18FNOS/c1-3-4-12(13(17)16-2)15-9-10-5-7-11(14)8-6-10/h5-8,12,15H,3-4,9H2,1-2H3/t12-/m0/s1.
What are the key properties of O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate?
O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate has a molecular weight of 255.36 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl (2S)-2-[(4-fluorophenyl)methylamino]pentanethioate is sourced from PubChem (CID 87770893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).