C28H32F3N9O5 — CID 87771206
[3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]-N-(cyclohexylcarbamoyl)anilino] 2,2,2-trifluoroacetate (PubChem CID 87771206) has the molecular formula C28H32F3N9O5 and a molecular weight of 631.62 g/mol. Its IUPAC name is [3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]-N-(cyclohexylcarbamoyl)anilino] 2,2,2-trifluoroacetate.
| Compound Name | [3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]-N-(cyclohexylcarbamoyl)anilino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87771206 |
| Molecular Formula | C28H32F3N9O5 |
| Molecular Weight | 631.62 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | [3-[2-(4-amino-1,2,5-oxadiazol-3-yl)-7-(3-aminopropoxy)-1-ethylimidazo[4,5-c]pyridin-4-yl]-N-(cyclohexylcarbamoyl)anilino] 2,2,2-trifluoroacetate |
| SMILES | CCn1c(-c2nonc2N)nc2c(-c3cccc(N(OC(=O)C(F)(F)F)C(=O)NC4CCCCC4)c3)ncc(OCCCN)c21 |
| InChI | InChI=1S/C28H32F3N9O5/c1-2-39-23-19(43-13-7-12-32)15-34-20(21(23)36-25(39)22-24(33)38-45-37-22)16-8-6-11-18(14-16)40(44-26(41)28(29,30)31)27(42)35-17-9-4-3-5-10-17/h6,8,11,14-15,17H,2-5,7,9-10,12-13,32H2,1H3,(H2,33,38)(H,35,42) |
| InChIKey | PILILIRRXRUUEG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 189.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|