C16H18F6O6 — CID 87772147
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] prop-2-enoate;2,2,3,4,4,4-hexafluorobutyl prop-2-enoate (PubChem CID 87772147) has the molecular formula C16H18F6O6 and a molecular weight of 420.30 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] prop-2-enoate;2,2,3,4,4,4-hexafluorobutyl prop-2-enoate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] prop-2-enoate;2,2,3,4,4,4-hexafluorobutyl prop-2-enoate |
|---|---|
| PubChem CID | 87772147 |
| Molecular Formula | C16H18F6O6 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] prop-2-enoate;2,2,3,4,4,4-hexafluorobutyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)C(F)(F)F.C=CC(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C9H12O4.C7H6F6O2/c1-4-6(10)13-7-8(11)12-5-9(7,2)3;1-2-4(14)15-3-6(9,10)5(8)7(11,12)13/h4,7H,1,5H2,2-3H3;2,5H,1,3H2/t7-;/m0./s1 |
| InChIKey | QVZAQGPRFRIZSG-FJXQXJEOSA-N |
| XLogP | 2.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|