About ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate
ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate (PubChem CID 87772214) has the molecular formula C10H27NO2
and a molecular weight of 193.33 g/mol. Its IUPAC name is ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate.
Molecular Properties
| Compound Name | ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate |
| PubChem CID | 87772214 |
| Molecular Formula | C10H27NO2 |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.20 |
| IUPAC Name | ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate |
| SMILES | CCN(C(C)C)C(C)C.CCO.O |
| InChI | InChI=1S/C8H19N.C2H6O.H2O/c1-6-9(7(2)3)8(4)5;1-2-3;/h7-8H,6H2,1-5H3;3H,2H2,1H3;1H2 |
| InChIKey | DMVQNLAECPFTGP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 54.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate?
The IUPAC name of ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate (CID 87772214) is ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate.
What is the SMILES notation for ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate?
The canonical SMILES for ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate is CCN(C(C)C)C(C)C.CCO.O.
What is the InChIKey of ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate?
The InChIKey is DMVQNLAECPFTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C2H6O.H2O/c1-6-9(7(2)3)8(4)5;1-2-3;/h7-8H,6H2,1-5H3;3H,2H2,1H3;1H2.
What are the key properties of ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate?
ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate has a molecular weight of 193.33 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;N-ethyl-N-propan-2-ylpropan-2-amine;hydrate is sourced from PubChem (CID 87772214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).