C30H17EuF3N2O4S3 — CID 87772755
europium;1,10-phenanthroline;4,4,4-trifluoro-2,2-bis(thiophene-2-carbonyl)-1-thiophen-2-ylbutane-1,3-dione (PubChem CID 87772755) has the molecular formula C30H17EuF3N2O4S3 and a molecular weight of 774.64 g/mol. Its IUPAC name is europium;1,10-phenanthroline;4,4,4-trifluoro-2,2-bis(thiophene-2-carbonyl)-1-thiophen-2-ylbutane-1,3-dione.
| Compound Name | europium;1,10-phenanthroline;4,4,4-trifluoro-2,2-bis(thiophene-2-carbonyl)-1-thiophen-2-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 87772755 |
| Molecular Formula | C30H17EuF3N2O4S3 |
| Molecular Weight | 774.64 g/mol |
| Exact Mass | 774.95 |
| IUPAC Name | europium;1,10-phenanthroline;4,4,4-trifluoro-2,2-bis(thiophene-2-carbonyl)-1-thiophen-2-ylbutane-1,3-dione |
| SMILES | O=C(c1cccs1)C(C(=O)c1cccs1)(C(=O)c1cccs1)C(=O)C(F)(F)F.[Eu].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C18H9F3O4S3.C12H8N2.Eu/c19-18(20,21)16(25)17(13(22)10-4-1-7-26-10,14(23)11-5-2-8-27-11)15(24)12-6-3-9-28-12;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-9H;1-8H; |
| InChIKey | JSWYKDZKFVQCOE-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.64 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|