C13H19N3O5 — CID 87772888
1-[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 87772888) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 87772888 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-[5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pentyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCCC(CC2CO2)CC2CO2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H19N3O5/c17-11-14-12(18)16(13(19)15-11)3-1-2-8(4-9-6-20-9)5-10-7-21-10/h8-10H,1-7H2,(H2,14,15,17,18,19) |
| InChIKey | RMJDMOAPBZRSLA-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|