C16H11F2NOS — CID 8777289
4-fluoro-N-(2-fluorophenyl)-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 8777289) has the molecular formula C16H11F2NOS and a molecular weight of 303.33 g/mol. Its IUPAC name is 4-fluoro-N-(2-fluorophenyl)-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-(2-fluorophenyl)-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 8777289 |
| Molecular Formula | C16H11F2NOS |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 4-fluoro-N-(2-fluorophenyl)-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2F)sc2cccc(F)c12 |
| InChI | InChI=1S/C16H11F2NOS/c1-9-14-11(18)6-4-8-13(14)21-15(9)16(20)19-12-7-3-2-5-10(12)17/h2-8H,1H3,(H,19,20) |
| InChIKey | SVMMQUUPGPQQDG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |