C8H16O5S — CID 87772924
(2R,3R,4R)-3,4,5-trihydroxy-2-(1-methylsulfanylethoxy)pentanal (PubChem CID 87772924) has the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. Its IUPAC name is (2R,3R,4R)-3,4,5-trihydroxy-2-(1-methylsulfanylethoxy)pentanal.
| Compound Name | (2R,3R,4R)-3,4,5-trihydroxy-2-(1-methylsulfanylethoxy)pentanal |
|---|---|
| PubChem CID | 87772924 |
| Molecular Formula | C8H16O5S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (2R,3R,4R)-3,4,5-trihydroxy-2-(1-methylsulfanylethoxy)pentanal |
| SMILES | CSC(C)O[C@@H](C=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O5S/c1-5(14-2)13-7(4-10)8(12)6(11)3-9/h4-9,11-12H,3H2,1-2H3/t5?,6-,7+,8-/m1/s1 |
| InChIKey | KQUFSWRCCALDGV-KTUCCBJNSA-N |
| XLogP | -1.01 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|