About 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride
2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride (PubChem CID 87773384) has the molecular formula C6H12ClF3N2O
and a molecular weight of 220.62 g/mol. Its IUPAC name is 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride |
| PubChem CID | 87773384 |
| Molecular Formula | C6H12ClF3N2O |
| Molecular Weight | 220.62 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride |
| SMILES | CC(C)(N)C(=O)NCC(F)(F)F.Cl |
| InChI | InChI=1S/C6H11F3N2O.ClH/c1-5(2,10)4(12)11-3-6(7,8)9;/h3,10H2,1-2H3,(H,11,12);1H |
| InChIKey | YPDBAWQVVKXAPB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.62 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride?
The IUPAC name of 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride (CID 87773384) is 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride.
What is the SMILES notation for 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride?
The canonical SMILES for 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride is CC(C)(N)C(=O)NCC(F)(F)F.Cl.
What is the InChIKey of 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride?
The InChIKey is YPDBAWQVVKXAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3N2O.ClH/c1-5(2,10)4(12)11-3-6(7,8)9;/h3,10H2,1-2H3,(H,11,12);1H.
What are the key properties of 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride?
2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride has a molecular weight of 220.62 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methyl-N-(2,2,2-trifluoroethyl)propanamide;hydrochloride is sourced from PubChem (CID 87773384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).