C19H19NO6S — CID 8777341
(4-methoxycarbonylphenyl) 1-methylsulfonyl-3,4-dihydro-2H-quinoline-6-carboxylate (PubChem CID 8777341) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 1-methylsulfonyl-3,4-dihydro-2H-quinoline-6-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) 1-methylsulfonyl-3,4-dihydro-2H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 8777341 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (4-methoxycarbonylphenyl) 1-methylsulfonyl-3,4-dihydro-2H-quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H19NO6S/c1-25-18(21)13-5-8-16(9-6-13)26-19(22)15-7-10-17-14(12-15)4-3-11-20(17)27(2,23)24/h5-10,12H,3-4,11H2,1-2H3 |
| InChIKey | GRZLFPHVLNRJNN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|