About 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide
4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide (PubChem CID 87773837) has the molecular formula C15H19NO5
and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide.
Molecular Properties
| Compound Name | 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide |
| PubChem CID | 87773837 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide |
| SMILES | [O-][N+](CC1CO1)(CC1CO1)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C15H19NO5/c17-16(5-13-7-19-13,6-14-8-20-14)11-1-3-12(4-2-11)18-9-15-10-21-15/h1-4,13-15H,5-10H2 |
| InChIKey | RPFVGVCMQZIRDM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide?
The IUPAC name of 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide (CID 87773837) is 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide.
What is the SMILES notation for 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide?
The canonical SMILES for 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide is [O-][N+](CC1CO1)(CC1CO1)c1ccc(OCC2CO2)cc1.
What is the InChIKey of 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide?
The InChIKey is RPFVGVCMQZIRDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5/c17-16(5-13-7-19-13,6-14-8-20-14)11-1-3-12(4-2-11)18-9-15-10-21-15/h1-4,13-15H,5-10H2.
What are the key properties of 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide?
4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide has a molecular weight of 293.32 g/mol, XLogP of 1.07, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxiran-2-ylmethoxy)-N,N-bis(oxiran-2-ylmethyl)benzeneamine oxide is sourced from PubChem (CID 87773837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).