C32H29F3N3O5+ — CID 87775725
[(2R,4R)-1-benzyl-4-methoxy-2-[[2-(2-oxo-1H-quinolin-3-yl)-1H-indol-5-yl]oxymethyl]pyrrolidin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 87775725) has the molecular formula C32H29F3N3O5+ and a molecular weight of 592.59 g/mol. Its IUPAC name is [(2R,4R)-1-benzyl-4-methoxy-2-[[2-(2-oxo-1H-quinolin-3-yl)-1H-indol-5-yl]oxymethyl]pyrrolidin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,4R)-1-benzyl-4-methoxy-2-[[2-(2-oxo-1H-quinolin-3-yl)-1H-indol-5-yl]oxymethyl]pyrrolidin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87775725 |
| Molecular Formula | C32H29F3N3O5+ |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | [(2R,4R)-1-benzyl-4-methoxy-2-[[2-(2-oxo-1H-quinolin-3-yl)-1H-indol-5-yl]oxymethyl]pyrrolidin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CO[C@@H]1C[C@H](COc2ccc3[nH]c(-c4cc5ccccc5[nH]c4=O)cc3c2)[N+](Cc2ccccc2)(OC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C32H28F3N3O5/c1-41-25-16-23(38(18-25,43-31(40)32(33,34)35)17-20-7-3-2-4-8-20)19-42-24-11-12-28-22(13-24)15-29(36-28)26-14-21-9-5-6-10-27(21)37-30(26)39/h2-15,23,25,36H,16-19H2,1H3/p+1/t23-,25-,38?/m1/s1 |
| InChIKey | SZMONWYDJHSYAC-HYXUGZOWSA-O |
| XLogP | 5.88 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|