C28H42O2 — CID 87776402
(4S)-2-methyl-6-methylideneocta-2,7-dien-4-ol;2-phenylethanol;2,6,6-trimethylbicyclo[3.1.1]hept-2-ene (PubChem CID 87776402) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is (4S)-2-methyl-6-methylideneocta-2,7-dien-4-ol;2-phenylethanol;2,6,6-trimethylbicyclo[3.1.1]hept-2-ene.
| Compound Name | (4S)-2-methyl-6-methylideneocta-2,7-dien-4-ol;2-phenylethanol;2,6,6-trimethylbicyclo[3.1.1]hept-2-ene |
|---|---|
| PubChem CID | 87776402 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | (4S)-2-methyl-6-methylideneocta-2,7-dien-4-ol;2-phenylethanol;2,6,6-trimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | C=CC(=C)C[C@H](O)C=C(C)C.CC1=CCC2CC1C2(C)C.OCCc1ccccc1 |
| InChI | InChI=1S/C10H16O.C10H16.C8H10O/c1-5-9(4)7-10(11)6-8(2)3;1-7-4-5-8-6-9(7)10(8,2)3;9-7-6-8-4-2-1-3-5-8/h5-6,10-11H,1,4,7H2,2-3H3;4,8-9H,5-6H2,1-3H3;1-5,9H,6-7H2/t10-;;/m1../s1 |
| InChIKey | JWNSFZIYNQPHNO-YQFADDPSSA-N |
| XLogP | 6.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|