C20H27N3O3S — CID 8777655
N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 8777655) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 8777655 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | C[C@H](NC(=O)C1=CC=CN2CCS(=O)(=O)N=C12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H27N3O3S/c1-13(20-10-14-7-15(11-20)9-16(8-14)12-20)21-19(24)17-3-2-4-23-5-6-27(25,26)22-18(17)23/h2-4,13-16H,5-12H2,1H3,(H,21,24)/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | HRMMUEMSGYXEHV-IVKJLDKCSA-N |
| XLogP | 2.21 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |