About diheptyl(dioctyl)azanium chloride
diheptyl(dioctyl)azanium chloride (PubChem CID 87777237) has the molecular formula C30H64ClN
and a molecular weight of 474.30 g/mol. Its IUPAC name is diheptyl(dioctyl)azanium chloride.
Molecular Properties
| Compound Name | diheptyl(dioctyl)azanium chloride |
| PubChem CID | 87777237 |
| Molecular Formula | C30H64ClN |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.47 |
| IUPAC Name | diheptyl(dioctyl)azanium chloride |
| SMILES | CCCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C30H64N.ClH/c1-5-9-13-17-21-25-29-31(27-23-19-15-11-7-3,28-24-20-16-12-8-4)30-26-22-18-14-10-6-2;/h5-30H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XPGHWFOWBLBBNK-UHFFFAOYSA-M |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diheptyl(dioctyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diheptyl(dioctyl)azanium chloride?
The IUPAC name of diheptyl(dioctyl)azanium chloride (CID 87777237) is diheptyl(dioctyl)azanium chloride.
What is the SMILES notation for diheptyl(dioctyl)azanium chloride?
The canonical SMILES for diheptyl(dioctyl)azanium chloride is CCCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCCC.[Cl-].
What is the InChIKey of diheptyl(dioctyl)azanium chloride?
The InChIKey is XPGHWFOWBLBBNK-UHFFFAOYSA-M. The full InChI is InChI=1S/C30H64N.ClH/c1-5-9-13-17-21-25-29-31(27-23-19-15-11-7-3,28-24-20-16-12-8-4)30-26-22-18-14-10-6-2;/h5-30H2,1-4H3;1H/q+1;/p-1.
What are the key properties of diheptyl(dioctyl)azanium chloride?
diheptyl(dioctyl)azanium chloride has a molecular weight of 474.30 g/mol, XLogP of 7.47, 26 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diheptyl(dioctyl)azanium chloride is sourced from PubChem (CID 87777237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).