3,5-bis(furan-2-carbonylamino)benzoic acid

C17H12N2O6 — CID 877786

IUPAC3,5-bis(furan-2-carbonylamino)benzoic acid
SMILESO=C(O)c1cc(NC(=O)c2ccco2)cc(NC(=O)c2ccco2)c1
InChIInChI=1S/C17H12N2O6/c20-15(13-3-1-5-24-13)18-11-7-10(17(22)23)8-12(9-11)19-16(21)14-4-2-6-25-14/h1-9H,(H,18,20)(H,19,21)(H,22,23)
InChIKeyJQFVFZUCZIUGMT-UHFFFAOYSA-N
MW340.29 g/mol
LogP3.08
Rot. Bonds5

About 3,5-bis(furan-2-carbonylamino)benzoic acid

3,5-bis(furan-2-carbonylamino)benzoic acid (PubChem CID 877786) has the molecular formula C17H12N2O6 and a molecular weight of 340.29 g/mol. Its IUPAC name is 3,5-bis(furan-2-carbonylamino)benzoic acid.

Molecular Properties

Compound Name3,5-bis(furan-2-carbonylamino)benzoic acid
PubChem CID877786
Molecular FormulaC17H12N2O6
Molecular Weight340.29 g/mol
Exact Mass340.07
IUPAC Name3,5-bis(furan-2-carbonylamino)benzoic acid
SMILESO=C(O)c1cc(NC(=O)c2ccco2)cc(NC(=O)c2ccco2)c1
InChIInChI=1S/C17H12N2O6/c20-15(13-3-1-5-24-13)18-11-7-10(17(22)23)8-12(9-11)19-16(21)14-4-2-6-25-14/h1-9H,(H,18,20)(H,19,21)(H,22,23)
InChIKeyJQFVFZUCZIUGMT-UHFFFAOYSA-N
XLogP3.08
TPSA121.78 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.29
LogP ≤ 53.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 3,5-bis(furan-2-carbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis(furan-2-carbonylamino)benzoic acid?
The IUPAC name of 3,5-bis(furan-2-carbonylamino)benzoic acid (CID 877786) is 3,5-bis(furan-2-carbonylamino)benzoic acid.
What is the SMILES notation for 3,5-bis(furan-2-carbonylamino)benzoic acid?
The canonical SMILES for 3,5-bis(furan-2-carbonylamino)benzoic acid is O=C(O)c1cc(NC(=O)c2ccco2)cc(NC(=O)c2ccco2)c1.
What is the InChIKey of 3,5-bis(furan-2-carbonylamino)benzoic acid?
The InChIKey is JQFVFZUCZIUGMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O6/c20-15(13-3-1-5-24-13)18-11-7-10(17(22)23)8-12(9-11)19-16(21)14-4-2-6-25-14/h1-9H,(H,18,20)(H,19,21)(H,22,23).
What are the key properties of 3,5-bis(furan-2-carbonylamino)benzoic acid?
3,5-bis(furan-2-carbonylamino)benzoic acid has a molecular weight of 340.29 g/mol, XLogP of 3.08, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(furan-2-carbonylamino)benzoic acid is sourced from PubChem (CID 877786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).