diethyl(dimethyl)phosphanium chloride

C6H16ClP — CID 87778671

IUPACdiethyl(dimethyl)phosphanium chloride
SMILESCC[P+](C)(C)CC.[Cl-]
InChIInChI=1S/C6H16P.ClH/c1-5-7(3,4)6-2;/h5-6H2,1-4H3;1H/q+1;/p-1
InChIKeySPAMWOOBQLJBHM-UHFFFAOYSA-M
MW154.62 g/mol
LogP-0.69
Rot. Bonds2

About diethyl(dimethyl)phosphanium chloride

diethyl(dimethyl)phosphanium chloride (PubChem CID 87778671) has the molecular formula C6H16ClP and a molecular weight of 154.62 g/mol. Its IUPAC name is diethyl(dimethyl)phosphanium chloride.

Molecular Properties

Compound Namediethyl(dimethyl)phosphanium chloride
PubChem CID87778671
Molecular FormulaC6H16ClP
Molecular Weight154.62 g/mol
Exact Mass154.07
IUPAC Namediethyl(dimethyl)phosphanium chloride
SMILESCC[P+](C)(C)CC.[Cl-]
InChIInChI=1S/C6H16P.ClH/c1-5-7(3,4)6-2;/h5-6H2,1-4H3;1H/q+1;/p-1
InChIKeySPAMWOOBQLJBHM-UHFFFAOYSA-M
XLogP-0.69
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.62
LogP ≤ 5-0.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze diethyl(dimethyl)phosphanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl(dimethyl)phosphanium chloride?
The IUPAC name of diethyl(dimethyl)phosphanium chloride (CID 87778671) is diethyl(dimethyl)phosphanium chloride.
What is the SMILES notation for diethyl(dimethyl)phosphanium chloride?
The canonical SMILES for diethyl(dimethyl)phosphanium chloride is CC[P+](C)(C)CC.[Cl-].
What is the InChIKey of diethyl(dimethyl)phosphanium chloride?
The InChIKey is SPAMWOOBQLJBHM-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H16P.ClH/c1-5-7(3,4)6-2;/h5-6H2,1-4H3;1H/q+1;/p-1.
What are the key properties of diethyl(dimethyl)phosphanium chloride?
diethyl(dimethyl)phosphanium chloride has a molecular weight of 154.62 g/mol, XLogP of -0.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(dimethyl)phosphanium chloride is sourced from PubChem (CID 87778671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).