C27H13BF15OSi- — CID 87778714
[4-[methoxy(dimethyl)silyl]phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 87778714) has the molecular formula C27H13BF15OSi- and a molecular weight of 677.27 g/mol. Its IUPAC name is [4-[methoxy(dimethyl)silyl]phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [4-[methoxy(dimethyl)silyl]phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 87778714 |
| Molecular Formula | C27H13BF15OSi- |
| Molecular Weight | 677.27 g/mol |
| Exact Mass | 677.06 |
| IUPAC Name | [4-[methoxy(dimethyl)silyl]phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CO[Si](C)(C)c1ccc([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C27H13BF15OSi/c1-44-45(2,3)9-6-4-8(5-7-9)28(10-13(29)19(35)25(41)20(36)14(10)30,11-15(31)21(37)26(42)22(38)16(11)32)12-17(33)23(39)27(43)24(40)18(12)34/h4-7H,1-3H3/q-1 |
| InChIKey | HJWJFJBRSSHUHQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.27 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|