C50H64ClN3O10 — CID 87779223
[6-[3-[4-(3-chlorophenyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]propanoylamino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 87779223) has the molecular formula C50H64ClN3O10 and a molecular weight of 902.53 g/mol. Its IUPAC name is [6-[3-[4-(3-chlorophenyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]propanoylamino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [6-[3-[4-(3-chlorophenyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]propanoylamino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87779223 |
| Molecular Formula | C50H64ClN3O10 |
| Molecular Weight | 902.53 g/mol |
| Exact Mass | 901.43 |
| IUPAC Name | [6-[3-[4-(3-chlorophenyl)-7-ethyl-2-phenylpyrrolo[1,2-b]pyridazin-3-yl]propanoylamino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCc1ccc2c(-c3cccc(Cl)c3)c(CCC(=O)NC3OC(COC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C3OC(=O)C(C)(C)C)c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C50H64ClN3O10/c1-14-32-23-25-34-37(30-21-18-22-31(51)27-30)33(38(53-54(32)34)29-19-16-15-17-20-29)24-26-36(55)52-42-41(64-46(59)50(11,12)13)40(63-45(58)49(8,9)10)39(62-44(57)48(5,6)7)35(61-42)28-60-43(56)47(2,3)4/h15-23,25,27,35,39-42H,14,24,26,28H2,1-13H3,(H,52,55) |
| InChIKey | RPYMTZOIOARGIY-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.53 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|