About 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine
1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine (PubChem CID 87779255) has the molecular formula C11H15Cl2N3
and a molecular weight of 260.17 g/mol. Its IUPAC name is 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine.
Molecular Properties
| Compound Name | 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine |
| PubChem CID | 87779255 |
| Molecular Formula | C11H15Cl2N3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine |
| SMILES | CNC1CCCCN1c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N3/c1-14-10-4-2-3-5-16(10)8-6-9(12)11(13)15-7-8/h6-7,10,14H,2-5H2,1H3 |
| InChIKey | OHAFBZDSUDWREV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine?
The IUPAC name of 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine (CID 87779255) is 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine.
What is the SMILES notation for 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine?
The canonical SMILES for 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine is CNC1CCCCN1c1cnc(Cl)c(Cl)c1.
What is the InChIKey of 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine?
The InChIKey is OHAFBZDSUDWREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2N3/c1-14-10-4-2-3-5-16(10)8-6-9(12)11(13)15-7-8/h6-7,10,14H,2-5H2,1H3.
What are the key properties of 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine?
1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine has a molecular weight of 260.17 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dichloro-3-pyridinyl)-N-methylpiperidin-2-amine is sourced from PubChem (CID 87779255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).