About 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride (PubChem CID 87779430) has the molecular formula C18H16ClF6NO2
and a molecular weight of 427.77 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride.
Molecular Properties
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride |
| PubChem CID | 87779430 |
| Molecular Formula | C18H16ClF6NO2 |
| Molecular Weight | 427.77 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride |
| SMILES | Cl.NC(=O)C(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H15F6NO2.ClH/c19-17(20,21)13-6-11(7-14(8-13)18(22,23)24)9-27-10-15(16(25)26)12-4-2-1-3-5-12;/h1-8,15H,9-10H2,(H2,25,26);1H |
| InChIKey | ZLVLUIXVCFXKAX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.77 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride?
The IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride (CID 87779430) is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride.
What is the SMILES notation for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride?
The canonical SMILES for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride is Cl.NC(=O)C(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1.
What is the InChIKey of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride?
The InChIKey is ZLVLUIXVCFXKAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F6NO2.ClH/c19-17(20,21)13-6-11(7-14(8-13)18(22,23)24)9-27-10-15(16(25)26)12-4-2-1-3-5-12;/h1-8,15H,9-10H2,(H2,25,26);1H.
What are the key properties of 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride?
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride has a molecular weight of 427.77 g/mol, XLogP of 4.93, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpropanamide;hydrochloride is sourced from PubChem (CID 87779430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).