C9H18F3N3O2 — CID 87779466
2,2,2-trifluoroacetate;trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium (PubChem CID 87779466) has the molecular formula C9H18F3N3O2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium.
| Compound Name | 2,2,2-trifluoroacetate;trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium |
|---|---|
| PubChem CID | 87779466 |
| Molecular Formula | C9H18F3N3O2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2,2,2-trifluoroacetate;trimethyl-(N,N,N'-trimethylcarbamimidoyl)azanium |
| SMILES | C/N=C(\N(C)C)[N+](C)(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H18N3.C2HF3O2/c1-8-7(9(2)3)10(4,5)6;3-2(4,5)1(6)7/h1-6H3;(H,6,7)/q+1;/p-1/b8-7+; |
| InChIKey | XXWFTQXVBPFFCN-USRGLUTNSA-M |
| XLogP | -0.46 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|