C26H31N7O5S — CID 87779470
2-[(E)-C-[5-[3-[4-(pyridine-3-carbonylamino)butylamino]propylcarbamoyl]-2-pyridinyl]carbonohydrazonoyl]benzenesulfonic acid (PubChem CID 87779470) has the molecular formula C26H31N7O5S and a molecular weight of 553.65 g/mol. Its IUPAC name is 2-[(E)-C-[5-[3-[4-(pyridine-3-carbonylamino)butylamino]propylcarbamoyl]-2-pyridinyl]carbonohydrazonoyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-C-[5-[3-[4-(pyridine-3-carbonylamino)butylamino]propylcarbamoyl]-2-pyridinyl]carbonohydrazonoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87779470 |
| Molecular Formula | C26H31N7O5S |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 2-[(E)-C-[5-[3-[4-(pyridine-3-carbonylamino)butylamino]propylcarbamoyl]-2-pyridinyl]carbonohydrazonoyl]benzenesulfonic acid |
| SMILES | N/N=C(/c1ccc(C(=O)NCCCNCCCCNC(=O)c2cccnc2)cn1)c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C26H31N7O5S/c27-33-24(21-8-1-2-9-23(21)39(36,37)38)22-11-10-20(18-32-22)26(35)31-16-6-14-28-12-3-4-15-30-25(34)19-7-5-13-29-17-19/h1-2,5,7-11,13,17-18,28H,3-4,6,12,14-16,27H2,(H,30,34)(H,31,35)(H,36,37,38)/b33-24+ |
| InChIKey | RVZICCQBSZGJSN-IWBSIUBASA-N |
| XLogP | 1.35 |
| TPSA | 188.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|