C28H32N6OS — CID 87779607
(E)-N-methoxy-1-[3-[3-[(4-methyl-5-quinolin-6-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]ethanimine (PubChem CID 87779607) has the molecular formula C28H32N6OS and a molecular weight of 500.67 g/mol. Its IUPAC name is (E)-N-methoxy-1-[3-[3-[(4-methyl-5-quinolin-6-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]ethanimine.
| Compound Name | (E)-N-methoxy-1-[3-[3-[(4-methyl-5-quinolin-6-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]ethanimine |
|---|---|
| PubChem CID | 87779607 |
| Molecular Formula | C28H32N6OS |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | (E)-N-methoxy-1-[3-[3-[(4-methyl-5-quinolin-6-yl-1,2,4-triazol-3-yl)sulfanyl]propyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]ethanimine |
| SMILES | CO/N=C(\C)c1ccc2c(c1)CCN(CCCSc1nnc(-c3ccc4ncccc4c3)n1C)CC2 |
| InChI | InChI=1S/C28H32N6OS/c1-20(32-35-3)22-8-7-21-11-15-34(16-12-23(21)18-22)14-5-17-36-28-31-30-27(33(28)2)25-9-10-26-24(19-25)6-4-13-29-26/h4,6-10,13,18-19H,5,11-12,14-17H2,1-3H3/b32-20+ |
| InChIKey | YMEJNULFFKECFQ-UZWMFBFFSA-N |
| XLogP | 4.98 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|