About [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate
[2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate (PubChem CID 87780298) has the molecular formula C16H10ClF4NO3
and a molecular weight of 375.71 g/mol. Its IUPAC name is [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate |
| PubChem CID | 87780298 |
| Molecular Formula | C16H10ClF4NO3 |
| Molecular Weight | 375.71 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(-c2ccc(F)c(Cl)c2)c(NC(=O)OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10ClF4NO3/c1-8-2-4-10(9-3-5-12(18)11(17)7-9)13(6-8)22-15(24)25-14(23)16(19,20)21/h2-7H,1H3,(H,22,24) |
| InChIKey | SJIUYFIJBCXOPV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate?
The IUPAC name of [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate (CID 87780298) is [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate.
What is the SMILES notation for [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate?
The canonical SMILES for [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate is Cc1ccc(-c2ccc(F)c(Cl)c2)c(NC(=O)OC(=O)C(F)(F)F)c1.
What is the InChIKey of [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate?
The InChIKey is SJIUYFIJBCXOPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClF4NO3/c1-8-2-4-10(9-3-5-12(18)11(17)7-9)13(6-8)22-15(24)25-14(23)16(19,20)21/h2-7H,1H3,(H,22,24).
What are the key properties of [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate?
[2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate has a molecular weight of 375.71 g/mol, XLogP of 5.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chloro-4-fluorophenyl)-5-methylphenyl]carbamoyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 87780298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).