About methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate
methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate (PubChem CID 87780748) has the molecular formula C31H22F6O4
and a molecular weight of 572.50 g/mol. Its IUPAC name is methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate.
Molecular Properties
| Compound Name | methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate |
| PubChem CID | 87780748 |
| Molecular Formula | C31H22F6O4 |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1c2c(c3cc(OC)ccc3c1C)OC(c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)C=C2 |
| InChI | InChI=1S/C31H22F6O4/c1-17-23-11-10-22(39-2)16-25(23)27-24(26(17)28(38)40-3)12-13-29(41-27,18-6-4-8-20(14-18)30(32,33)34)19-7-5-9-21(15-19)31(35,36)37/h4-16H,1-3H3 |
| InChIKey | FGOBGMJZOIYIPK-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate?
The IUPAC name of methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate (CID 87780748) is methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate.
What is the SMILES notation for methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate?
The canonical SMILES for methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate is COC(=O)c1c2c(c3cc(OC)ccc3c1C)OC(c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)C=C2.
What is the InChIKey of methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate?
The InChIKey is FGOBGMJZOIYIPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22F6O4/c1-17-23-11-10-22(39-2)16-25(23)27-24(26(17)28(38)40-3)12-13-29(41-27,18-6-4-8-20(14-18)30(32,33)34)19-7-5-9-21(15-19)31(35,36)37/h4-16H,1-3H3.
What are the key properties of methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate?
methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate has a molecular weight of 572.50 g/mol, XLogP of 8.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-methoxy-6-methyl-2,2-bis[3-(trifluoromethyl)phenyl]benzo[h]chromene-5-carboxylate is sourced from PubChem (CID 87780748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).