C11H16Cl2N2O — CID 87780937
trans-(1R,2R)-1-[(6-chloro-3-pyridinyl)oxymethyl]-N,2-dimethylcyclopropan-1-amine;hydrochloride (PubChem CID 87780937) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is trans-(1R,2R)-1-[(6-chloro-3-pyridinyl)oxymethyl]-N,2-dimethylcyclopropan-1-amine;hydrochloride.
| Compound Name | trans-(1R,2R)-1-[(6-chloro-3-pyridinyl)oxymethyl]-N,2-dimethylcyclopropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 87780937 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | trans-(1R,2R)-1-[(6-chloro-3-pyridinyl)oxymethyl]-N,2-dimethylcyclopropan-1-amine;hydrochloride |
| SMILES | CN[C@]1(COc2ccc(Cl)nc2)C[C@H]1C.Cl |
| InChI | InChI=1S/C11H15ClN2O.ClH/c1-8-5-11(8,13-2)7-15-9-3-4-10(12)14-6-9;/h3-4,6,8,13H,5,7H2,1-2H3;1H/t8-,11+;/m1./s1 |
| InChIKey | NBMNHCVVYZRVCY-NINOIYOQSA-N |
| XLogP | 2.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|