C28H25F9O5S2 — CID 87781845
[[4-(2-ethenoxyethoxy)-3,5-dimethylphenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87781845) has the molecular formula C28H25F9O5S2 and a molecular weight of 676.62 g/mol. Its IUPAC name is [[4-(2-ethenoxyethoxy)-3,5-dimethylphenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[4-(2-ethenoxyethoxy)-3,5-dimethylphenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87781845 |
| Molecular Formula | C28H25F9O5S2 |
| Molecular Weight | 676.62 g/mol |
| Exact Mass | 676.10 |
| IUPAC Name | [[4-(2-ethenoxyethoxy)-3,5-dimethylphenyl]-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | C=COCCOc1c(C)cc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C28H25F9O5S2/c1-4-40-15-16-41-24-19(2)17-23(18-20(24)3)43(21-11-7-5-8-12-21,22-13-9-6-10-14-22)42-44(38,39)28(36,37)26(31,32)25(29,30)27(33,34)35/h4-14,17-18H,1,15-16H2,2-3H3 |
| InChIKey | UQHKOJGCKKIINW-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.62 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|