About 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid
3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid (PubChem CID 87781849) has the molecular formula C18H18Cl2FNO5S
and a molecular weight of 450.32 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid.
Molecular Properties
| Compound Name | 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid |
| PubChem CID | 87781849 |
| Molecular Formula | C18H18Cl2FNO5S |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid |
| SMILES | Cc1cc(COc2c(Cl)cc(CC(F)C(=O)O)cc2Cl)cc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H18Cl2FNO5S/c1-10-3-12(5-13(4-10)22-28(2,25)26)9-27-17-14(19)6-11(7-15(17)20)8-16(21)18(23)24/h3-7,16,22H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | HRNNUIAVTMWVNW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid?
The IUPAC name of 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid (CID 87781849) is 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid.
What is the SMILES notation for 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid?
The canonical SMILES for 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid is Cc1cc(COc2c(Cl)cc(CC(F)C(=O)O)cc2Cl)cc(NS(C)(=O)=O)c1.
What is the InChIKey of 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid?
The InChIKey is HRNNUIAVTMWVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2FNO5S/c1-10-3-12(5-13(4-10)22-28(2,25)26)9-27-17-14(19)6-11(7-15(17)20)8-16(21)18(23)24/h3-7,16,22H,8-9H2,1-2H3,(H,23,24).
What are the key properties of 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid?
3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid has a molecular weight of 450.32 g/mol, XLogP of 4.22, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dichloro-4-[[3-(methanesulfonamido)-5-methylphenyl]methoxy]phenyl]-2-fluoropropanoic acid is sourced from PubChem (CID 87781849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).