C22H12Cl4O8 — CID 87782020
6,8-dichloro-3-(6,8-dichloro-4-hydroxy-2-oxochromen-3-yl)-2,2-dimethoxy-3H-furo[3,2-c]chromen-4-one (PubChem CID 87782020) has the molecular formula C22H12Cl4O8 and a molecular weight of 546.14 g/mol. Its IUPAC name is 6,8-dichloro-3-(6,8-dichloro-4-hydroxy-2-oxochromen-3-yl)-2,2-dimethoxy-3H-furo[3,2-c]chromen-4-one.
| Compound Name | 6,8-dichloro-3-(6,8-dichloro-4-hydroxy-2-oxochromen-3-yl)-2,2-dimethoxy-3H-furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 87782020 |
| Molecular Formula | C22H12Cl4O8 |
| Molecular Weight | 546.14 g/mol |
| Exact Mass | 543.93 |
| IUPAC Name | 6,8-dichloro-3-(6,8-dichloro-4-hydroxy-2-oxochromen-3-yl)-2,2-dimethoxy-3H-furo[3,2-c]chromen-4-one |
| SMILES | COC1(OC)Oc2c(c(=O)oc3c(Cl)cc(Cl)cc23)C1c1c(O)c2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C22H12Cl4O8/c1-30-22(31-2)15(13-16(27)9-3-7(23)5-11(25)17(9)32-20(13)28)14-19(34-22)10-4-8(24)6-12(26)18(10)33-21(14)29/h3-6,15,27H,1-2H3 |
| InChIKey | KGWKTGAKQRBYHC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.14 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|