C22H11F5N2O5 — CID 87782656
(2,3,4,5,6-pentafluorophenyl) 2-(5-acetamido-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate (PubChem CID 87782656) has the molecular formula C22H11F5N2O5 and a molecular weight of 478.33 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-(5-acetamido-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-(5-acetamido-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 87782656 |
| Molecular Formula | C22H11F5N2O5 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-(5-acetamido-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate |
| SMILES | CC(=O)Nc1cc2c3c(cccc3c1)C(=O)N(CC(=O)Oc1c(F)c(F)c(F)c(F)c1F)C2=O |
| InChI | InChI=1S/C22H11F5N2O5/c1-8(30)28-10-5-9-3-2-4-11-14(9)12(6-10)22(33)29(21(11)32)7-13(31)34-20-18(26)16(24)15(23)17(25)19(20)27/h2-6H,7H2,1H3,(H,28,30) |
| InChIKey | RNYHABGYQKCNRT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|