C40H47N3O7S — CID 87782885
3-[4-[6-[benzyl-[2-oxo-1-(3-oxo-5-phenylmethoxy-4H-1,4-benzoxazin-8-yl)ethyl]amino]hexoxy]butyl]benzenesulfonamide (PubChem CID 87782885) has the molecular formula C40H47N3O7S and a molecular weight of 713.90 g/mol. Its IUPAC name is 3-[4-[6-[benzyl-[2-oxo-1-(3-oxo-5-phenylmethoxy-4H-1,4-benzoxazin-8-yl)ethyl]amino]hexoxy]butyl]benzenesulfonamide.
| Compound Name | 3-[4-[6-[benzyl-[2-oxo-1-(3-oxo-5-phenylmethoxy-4H-1,4-benzoxazin-8-yl)ethyl]amino]hexoxy]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87782885 |
| Molecular Formula | C40H47N3O7S |
| Molecular Weight | 713.90 g/mol |
| Exact Mass | 713.31 |
| IUPAC Name | 3-[4-[6-[benzyl-[2-oxo-1-(3-oxo-5-phenylmethoxy-4H-1,4-benzoxazin-8-yl)ethyl]amino]hexoxy]butyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CCCCOCCCCCCN(Cc2ccccc2)C(C=O)c2ccc(OCc3ccccc3)c3c2OCC(=O)N3)c1 |
| InChI | InChI=1S/C40H47N3O7S/c41-51(46,47)34-20-13-19-31(26-34)14-9-12-25-48-24-11-2-1-10-23-43(27-32-15-5-3-6-16-32)36(28-44)35-21-22-37(39-40(35)50-30-38(45)42-39)49-29-33-17-7-4-8-18-33/h3-8,13,15-22,26,28,36H,1-2,9-12,14,23-25,27,29-30H2,(H,42,45)(H2,41,46,47) |
| InChIKey | SLORZKYGDKVWHW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.90 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|