About 2-ethenylbut-3-enylurea
2-ethenylbut-3-enylurea (PubChem CID 87783517) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-ethenylbut-3-enylurea.
Molecular Properties
| Compound Name | 2-ethenylbut-3-enylurea |
| PubChem CID | 87783517 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-ethenylbut-3-enylurea |
| SMILES | C=CC(C=C)CNC(N)=O |
| InChI | InChI=1S/C7H12N2O/c1-3-6(4-2)5-9-7(8)10/h3-4,6H,1-2,5H2,(H3,8,9,10) |
| InChIKey | JUHFHQZMPOGNSL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylbut-3-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylbut-3-enylurea?
The IUPAC name of 2-ethenylbut-3-enylurea (CID 87783517) is 2-ethenylbut-3-enylurea.
What is the SMILES notation for 2-ethenylbut-3-enylurea?
The canonical SMILES for 2-ethenylbut-3-enylurea is C=CC(C=C)CNC(N)=O.
What is the InChIKey of 2-ethenylbut-3-enylurea?
The InChIKey is JUHFHQZMPOGNSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-3-6(4-2)5-9-7(8)10/h3-4,6H,1-2,5H2,(H3,8,9,10).
What are the key properties of 2-ethenylbut-3-enylurea?
2-ethenylbut-3-enylurea has a molecular weight of 140.19 g/mol, XLogP of 0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylbut-3-enylurea is sourced from PubChem (CID 87783517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).