C13H11F6N5O4S — CID 87784256
1-[4-methoxy-5-(trifluoromethyl)-2H-1,3,5-triazin-2-yl]-3-[2-(trifluoromethyl)phenyl]sulfonylurea (PubChem CID 87784256) has the molecular formula C13H11F6N5O4S and a molecular weight of 447.32 g/mol. Its IUPAC name is 1-[4-methoxy-5-(trifluoromethyl)-2H-1,3,5-triazin-2-yl]-3-[2-(trifluoromethyl)phenyl]sulfonylurea.
| Compound Name | 1-[4-methoxy-5-(trifluoromethyl)-2H-1,3,5-triazin-2-yl]-3-[2-(trifluoromethyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 87784256 |
| Molecular Formula | C13H11F6N5O4S |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 1-[4-methoxy-5-(trifluoromethyl)-2H-1,3,5-triazin-2-yl]-3-[2-(trifluoromethyl)phenyl]sulfonylurea |
| SMILES | COC1=NC(NC(=O)NS(=O)(=O)c2ccccc2C(F)(F)F)N=CN1C(F)(F)F |
| InChI | InChI=1S/C13H11F6N5O4S/c1-28-11-22-9(20-6-24(11)13(17,18)19)21-10(25)23-29(26,27)8-5-3-2-4-7(8)12(14,15)16/h2-6,9H,1H3,(H2,21,23,25) |
| InChIKey | SQUKBKOCPNUFAO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|