hydroxymethyl 2,2-bis(hydroxymethyl)butanoate

C7H14O5 — CID 87784974

IUPAChydroxymethyl 2,2-bis(hydroxymethyl)butanoate
SMILESCCC(CO)(CO)C(=O)OCO
InChIInChI=1S/C7H14O5/c1-2-7(3-8,4-9)6(11)12-5-10/h8-10H,2-5H2,1H3
InChIKeyQJKFYCTYXWLRRW-UHFFFAOYSA-N
MW178.18 g/mol
LogP-1.14
Rot. Bonds5

About hydroxymethyl 2,2-bis(hydroxymethyl)butanoate

hydroxymethyl 2,2-bis(hydroxymethyl)butanoate (PubChem CID 87784974) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is hydroxymethyl 2,2-bis(hydroxymethyl)butanoate.

Molecular Properties

Compound Namehydroxymethyl 2,2-bis(hydroxymethyl)butanoate
PubChem CID87784974
Molecular FormulaC7H14O5
Molecular Weight178.18 g/mol
Exact Mass178.08
IUPAC Namehydroxymethyl 2,2-bis(hydroxymethyl)butanoate
SMILESCCC(CO)(CO)C(=O)OCO
InChIInChI=1S/C7H14O5/c1-2-7(3-8,4-9)6(11)12-5-10/h8-10H,2-5H2,1H3
InChIKeyQJKFYCTYXWLRRW-UHFFFAOYSA-N
XLogP-1.14
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.18
LogP ≤ 5-1.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze hydroxymethyl 2,2-bis(hydroxymethyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydroxymethyl 2,2-bis(hydroxymethyl)butanoate?
The IUPAC name of hydroxymethyl 2,2-bis(hydroxymethyl)butanoate (CID 87784974) is hydroxymethyl 2,2-bis(hydroxymethyl)butanoate.
What is the SMILES notation for hydroxymethyl 2,2-bis(hydroxymethyl)butanoate?
The canonical SMILES for hydroxymethyl 2,2-bis(hydroxymethyl)butanoate is CCC(CO)(CO)C(=O)OCO.
What is the InChIKey of hydroxymethyl 2,2-bis(hydroxymethyl)butanoate?
The InChIKey is QJKFYCTYXWLRRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O5/c1-2-7(3-8,4-9)6(11)12-5-10/h8-10H,2-5H2,1H3.
What are the key properties of hydroxymethyl 2,2-bis(hydroxymethyl)butanoate?
hydroxymethyl 2,2-bis(hydroxymethyl)butanoate has a molecular weight of 178.18 g/mol, XLogP of -1.14, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethyl 2,2-bis(hydroxymethyl)butanoate is sourced from PubChem (CID 87784974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).